Products 1529855-02-4
CAS 1529855-02-4 is the registry number for (1R,3S)-3-(Trifluoromethyl)cyclohexanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine (CAS 1529855-02-4) is a chemical compound with the molecular formula C7H12F3N and a molecular weight of 167.17 g/mol. IUPAC name: cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine. InChIKey: FFCACAFKNHPVNI-NTSWFWBYSA-N.
| Molecular formula | C7H12F3N |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine |
| InChIKey | FFCACAFKNHPVNI-NTSWFWBYSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)N)C(F)(F)F |
Computed by PubChem (NCBI)