CAS 152999-86-5 is the registry number for 2,2'-((4-Fluoro-3-methylphenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-fluoro-3-methylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 152999-86-5) is a chemical compound with the molecular formula C16H15FN2 and a molecular weight of 254.30 g/mol. IUPAC name: 2-[(4-fluoro-3-methylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: OMKBYLBQVKJNKP-UHFFFAOYSA-N.
| Molecular formula | C16H15FN2 |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | 2-[(4-fluoro-3-methylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | OMKBYLBQVKJNKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C2=CC=CN2)C3=CC=CN3)F |
Computed by PubChem (NCBI)