CAS 1530-33-2 appears in our catalog under these names: 2-Propyltriphenylphosphonium Bromide, Isopropyltriphenylphosphonium bromide, Isopropyltriphenylphosphonium Bromide, >98.0%(HPLC)(T), Isopropyltriphenylphosphonium bromide 98%, Isopropyltriphenylphosphonium bromide, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 100g, 25g, 500g, 5g, 1kg, 10g.
Triphenyl(propan-2-yl)phosphanium bromide (CAS 1530-33-2) is a chemical compound with the molecular formula C21H22BrP and a molecular weight of 385.3 g/mol. IUPAC name: triphenyl(propan-2-yl)phosphanium bromide. InChIKey: HSOZCYIMJQTYEX-UHFFFAOYSA-M.
| Molecular formula | C21H22BrP |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | triphenyl(propan-2-yl)phosphanium bromide |
| InChIKey | HSOZCYIMJQTYEX-UHFFFAOYSA-M |
| SMILES | CC(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)