CAS 1530-35-4 is the registry number for Cinnamyltriphenylphosphonium chloride. Offered by: Chemat. Available pack sizes: 100g, 50g.
Triphenyl-[(E)-3-phenylprop-2-enyl]phosphanium chloride (CAS 1530-35-4) is a chemical compound with the molecular formula C27H24ClP and a molecular weight of 414.9 g/mol. IUPAC name: triphenyl-[(E)-3-phenylprop-2-enyl]phosphanium chloride. InChIKey: NBGQQOBCTPJEFE-ZUQRMPMESA-M.
| Molecular formula | C27H24ClP |
|---|---|
| Molecular weight | 414.9 g/mol |
| IUPAC name | triphenyl-[(E)-3-phenylprop-2-enyl]phosphanium chloride |
| InChIKey | NBGQQOBCTPJEFE-ZUQRMPMESA-M |
| SMILES | C1=CC=C(C=C1)/C=C/C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)