Products 1530-35-4

CAS 1530-35-4 is the registry number for Cinnamyltriphenylphosphonium chloride. Offered by: Chemat. Available pack sizes: 100g, 50g.

Structural formula: {0} (CAS {1})

Triphenyl-[(E)-3-phenylprop-2-enyl]phosphanium chloride (CAS 1530-35-4) is a chemical compound with the molecular formula C27H24ClP and a molecular weight of 414.9 g/mol. IUPAC name: triphenyl-[(E)-3-phenylprop-2-enyl]phosphanium chloride. InChIKey: NBGQQOBCTPJEFE-ZUQRMPMESA-M.

Identity
Molecular formulaC27H24ClP
Molecular weight414.9 g/mol
IUPAC nametriphenyl-[(E)-3-phenylprop-2-enyl]phosphanium chloride
InChIKeyNBGQQOBCTPJEFE-ZUQRMPMESA-M
SMILESC1=CC=C(C=C1)/C=C/C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)