Products 1530-43-4

CAS 1530-43-4 is the registry number for Benzhydryltriphenylphosphonium chloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Benzhydryl(triphenyl)phosphanium chloride (CAS 1530-43-4) is a chemical compound with the molecular formula C31H26ClP and a molecular weight of 465.0 g/mol. IUPAC name: benzhydryl(triphenyl)phosphanium chloride. InChIKey: PKMDZVYQEANDCP-UHFFFAOYSA-M.

Identity
Molecular formulaC31H26ClP
Molecular weight465.0 g/mol
IUPAC namebenzhydryl(triphenyl)phosphanium chloride
InChIKeyPKMDZVYQEANDCP-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5.[Cl-]

Computed by PubChem (NCBI)