CAS 1530-43-4 is the registry number for Benzhydryltriphenylphosphonium chloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl(triphenyl)phosphanium chloride (CAS 1530-43-4) is a chemical compound with the molecular formula C31H26ClP and a molecular weight of 465.0 g/mol. IUPAC name: benzhydryl(triphenyl)phosphanium chloride. InChIKey: PKMDZVYQEANDCP-UHFFFAOYSA-M.
| Molecular formula | C31H26ClP |
|---|---|
| Molecular weight | 465.0 g/mol |
| IUPAC name | benzhydryl(triphenyl)phosphanium chloride |
| InChIKey | PKMDZVYQEANDCP-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5.[Cl-] |
Computed by PubChem (NCBI)