Products 15300-97-7

CAS 15300-97-7 is the registry number for Diethyl acetoxyethylphosphonate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.

Structural formula: {0} (CAS {1})

2-diethoxyphosphorylethyl acetate (CAS 15300-97-7) is a chemical compound with the molecular formula C8H17O5P and a molecular weight of 224.19 g/mol. IUPAC name: 2-diethoxyphosphorylethyl acetate. InChIKey: TUJWGDXCTRWVDC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17O5P
Molecular weight224.19 g/mol
IUPAC name2-diethoxyphosphorylethyl acetate
InChIKeyTUJWGDXCTRWVDC-UHFFFAOYSA-N
SMILESCCOP(=O)(CCOC(=O)C)OCC

Computed by PubChem (NCBI)