CAS 153035-55-3 appears in our catalog under these names: tetra(4–Hydroxyboryphenyl)methane, (Methanetetrayltetrakis(benzene-4,1-diyl))tetraboronic acid 97%, (Methanetetrayltetrakis(benzene-4,1-diyl))tetraboronic acid, 97%, 97%, tetra(4-Hydroxyboryphenyl)methane, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-[tris(4-boronophenyl)methyl]phenyl]boronic acid (CAS 153035-55-3) is a chemical compound with the molecular formula C25H24B4O8 and a molecular weight of 495.7 g/mol. IUPAC name: [4-[tris(4-boronophenyl)methyl]phenyl]boronic acid. InChIKey: HUKKNLZHFLXUKJ-UHFFFAOYSA-N.
| Molecular formula | C25H24B4O8 |
|---|---|
| Molecular weight | 495.7 g/mol |
| IUPAC name | [4-[tris(4-boronophenyl)methyl]phenyl]boronic acid |
| InChIKey | HUKKNLZHFLXUKJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C2=CC=C(C=C2)B(O)O)(C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O |
Computed by PubChem (NCBI)