CAS 153064-93-8 is the registry number for Abacavir Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-2-(hydroxymethyl)cyclopentan-1-ol (CAS 153064-93-8) is a chemical compound with the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. IUPAC name: (1S,2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-2-(hydroxymethyl)cyclopentan-1-ol. InChIKey: YXNXDKZSYVDBET-QNSHHTMESA-N.
| Molecular formula | C14H20N6O2 |
|---|---|
| Molecular weight | 304.35 g/mol |
| IUPAC name | (1S,2R,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]-2-(hydroxymethyl)cyclopentan-1-ol |
| InChIKey | YXNXDKZSYVDBET-QNSHHTMESA-N |
| SMILES | C1CC1NC2=C3C(=NC(=N2)N)N(C=N3)[C@@H]4C[C@@H]([C@H](C4)O)CO |
Computed by PubChem (NCBI)