CAS 1530777-90-2 appears in our catalog under these names: Tos-peg7-ch2co2t-butyl ester, 95%, Tos–PEG6–CH2–Boc, Tos-PEG7-CH2CO2tBu, 95%, 95%, Tos-PEG6-CH2-Boc, 97.0%, Tos-PEG6-CH2-Boc, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 1 g, 250 mg, 100 mg.
Tert-butyl 2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 1530777-90-2) is a chemical compound with the molecular formula C25H42O11S and a molecular weight of 550.7 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: OIPLDSHYHFUPLX-UHFFFAOYSA-N.
| Molecular formula | C25H42O11S |
|---|---|
| Molecular weight | 550.7 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | OIPLDSHYHFUPLX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)