CAS 15310-02-8 is the registry number for N-(2-IODOPHENYL)BENZAMIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(2-iodophenyl)benzamide (CAS 15310-02-8) is a chemical compound with the molecular formula C13H10INO and a molecular weight of 323.13 g/mol. IUPAC name: N-(2-iodophenyl)benzamide. InChIKey: JNLAWMGPPJLSMA-UHFFFAOYSA-N.
| Molecular formula | C13H10INO |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | N-(2-iodophenyl)benzamide |
| InChIKey | JNLAWMGPPJLSMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2I |
Computed by PubChem (NCBI)