CAS 153150-84-6 is the registry number for Tyrphostin AG1112. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-5-[(Z)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1H-pyrazole-4-carbonitrile (CAS 153150-84-6) is a chemical compound with the molecular formula C15H10N6 and a molecular weight of 274.28 g/mol. IUPAC name: 3-amino-5-[(Z)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1H-pyrazole-4-carbonitrile. InChIKey: OJMXHLJIMZMFGX-WEVVVXLNSA-N.
| Molecular formula | C15H10N6 |
|---|---|
| Molecular weight | 274.28 g/mol |
| IUPAC name | 3-amino-5-[(Z)-1-cyano-2-(1H-indol-3-yl)ethenyl]-1H-pyrazole-4-carbonitrile |
| InChIKey | OJMXHLJIMZMFGX-WEVVVXLNSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C(\C#N)/C3=C(C(=NN3)N)C#N |
Computed by PubChem (NCBI)