CAS 1531504-82-1 appears in our catalog under these names: Ethyl 2-chloro-2-(3-chloro-4-fluorophenyl)acetate, 95%, Ethyl 2-chloro-2-(3-chloro-4-fluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
Ethyl 2-chloro-2-(3-chloro-4-fluorophenyl)acetate (CAS 1531504-82-1) is a chemical compound with the molecular formula C10H9Cl2FO2 and a molecular weight of 251.08 g/mol. IUPAC name: ethyl 2-chloro-2-(3-chloro-4-fluorophenyl)acetate. InChIKey: FJVIXJUEWMBJHE-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2FO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | ethyl 2-chloro-2-(3-chloro-4-fluorophenyl)acetate |
| InChIKey | FJVIXJUEWMBJHE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=C(C=C1)F)Cl)Cl |
Computed by PubChem (NCBI)