CAS 153204-92-3 appears in our catalog under these names: N-(4-Bromobenzyl)-1,1,1-trimethyl-n-(trimethylsilyl)silanamine, 95%, N–(4–Bromobenzyl)–1,1,1–trimethyl–N–(trimethylsilyl)silanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 10g, 5g, 250mg.
1-(4-bromophenyl)-N,N-bis(trimethylsilyl)methanamine (CAS 153204-92-3) is a chemical compound with the molecular formula C13H24BrNSi2 and a molecular weight of 330.41 g/mol. IUPAC name: 1-(4-bromophenyl)-N,N-bis(trimethylsilyl)methanamine. InChIKey: OKYGLTUIDZRFGS-UHFFFAOYSA-N.
| Molecular formula | C13H24BrNSi2 |
|---|---|
| Molecular weight | 330.41 g/mol |
| IUPAC name | 1-(4-bromophenyl)-N,N-bis(trimethylsilyl)methanamine |
| InChIKey | OKYGLTUIDZRFGS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N(CC1=CC=C(C=C1)Br)[Si](C)(C)C |
Computed by PubChem (NCBI)