CAS 153205-46-0 appears in our catalog under these names: Asimadoline, Asimadoline, 98+%, Asimadoline (EMD–61753), N-((S)-2-((S)-3-Hydroxypyrrolidin-1-yl)-1-phenylethyl)-N-methyl-2,2-diphenylacetamide, Asimadoline, 99.36%. Offered by: Chemat Brand, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 250mg, 1g, 5mg, 25mg, 10mg, 10mM (in 1ml dmso), 50mg.
N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methyl-2,2-diphenylacetamide (CAS 153205-46-0) is a chemical compound with the molecular formula C27H30N2O2 and a molecular weight of 414.5 g/mol. IUPAC name: N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methyl-2,2-diphenylacetamide. InChIKey: JHLHNYVMZCADTC-LOSJGSFVSA-N.
| Molecular formula | C27H30N2O2 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methyl-2,2-diphenylacetamide |
| InChIKey | JHLHNYVMZCADTC-LOSJGSFVSA-N |
| SMILES | CN([C@H](CN1CC[C@@H](C1)O)C2=CC=CC=C2)C(=O)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)