CAS 15322-26-6 is the registry number for L-Glutamato copper, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper 2-azanidylpentanedioate (CAS 15322-26-6) is a chemical compound with the molecular formula C5H6CuNO4- and a molecular weight of 207.65 g/mol. IUPAC name: copper 2-azanidylpentanedioate. InChIKey: SXBOEBVXYQFVJM-UHFFFAOYSA-L.
| Molecular formula | C5H6CuNO4- |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | copper 2-azanidylpentanedioate |
| InChIKey | SXBOEBVXYQFVJM-UHFFFAOYSA-L |
| SMILES | C(CC(=O)[O-])C(C(=O)[O-])[NH-].[Cu+2] |
Computed by PubChem (NCBI)