CAS 15323-35-0 appears in our catalog under these names: 1-(1,1,2,3,3,6-Hexamethyl-2,3-dihydro-1h-inden-5-yl)ethanone, 95%, Phantolide, >95% (HPLC), AHMI, AHMI 10 µg/mL in Cyclohexane, Phantolide. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, Biosynth, Chemat. Available pack sizes: 100mg, 500mg, 50mg, 25mg, 1ml, 5mg, 10mg, 1x25mg.
1-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)ethanone (CAS 15323-35-0) is a chemical compound with the molecular formula C17H24O and a molecular weight of 244.37 g/mol. IUPAC name: 1-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)ethanone. InChIKey: VDBHOHJWUDKDRW-UHFFFAOYSA-N.
| Molecular formula | C17H24O |
|---|---|
| Molecular weight | 244.37 g/mol |
| IUPAC name | 1-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)ethanone |
| InChIKey | VDBHOHJWUDKDRW-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(C1(C)C)C=C(C(=C2)C)C(=O)C)(C)C |
Computed by PubChem (NCBI)