Products 153252-36-9
CAS 153252-36-9 is the registry number for β-D-tetraacetylgalactopyranoside-PEG1-N3, 98.0%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 250 mg, 500 mg.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate (CAS 153252-36-9) is a chemical compound with the molecular formula C18H27N3O11 and a molecular weight of 461.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate. InChIKey: OFRJNIAQTXDUKV-DISONHOPSA-N.
| Molecular formula | C18H27N3O11 |
|---|---|
| Molecular weight | 461.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-(2-azidoethoxy)ethoxy]oxan-2-yl]methyl acetate |
| InChIKey | OFRJNIAQTXDUKV-DISONHOPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OCCOCCN=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)