CAS 153276-34-7 appears in our catalog under these names: 4-Chloro-5-(piperazin-1-yl)pyridazin-3(2H)-one, 98%, 4-Chloro-5-piperazin-1-ylpyridazin-3(2H)-one. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
5-chloro-4-piperazin-1-yl-1H-pyridazin-6-one (CAS 153276-34-7) is a chemical compound with the molecular formula C8H11ClN4O and a molecular weight of 214.65 g/mol. IUPAC name: 5-chloro-4-piperazin-1-yl-1H-pyridazin-6-one. InChIKey: ICFYLQIKMKKTQY-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN4O |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 5-chloro-4-piperazin-1-yl-1H-pyridazin-6-one |
| InChIKey | ICFYLQIKMKKTQY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C(=O)NN=C2)Cl |
Computed by PubChem (NCBI)