CAS 153277-35-1 appears in our catalog under these names: Anthraquinone-2-sulfonic acid sodium salt monohydrate, 98%, Sodium 9,10-dioxo-9,10-dihydroanthracene-2-sulfonate hydrate, 98%, Sodium Anthraquinone–2–sulfonate Monohydrate, 9,10-Anthraquinone-2-sulfonic acid sodium salt hydrate, 97% , Anthraquinone-2-sulfonic acid sodium salt monohydrate. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 5g, 500g, 25g, 2500g, 0,25kg, 0,1kg, 0,5kg.
Sodium;9,10-dioxoanthracene-2-sulfonate;hydrate (CAS 153277-35-1) is a chemical compound with the molecular formula C14H9NaO6S and a molecular weight of 328.27 g/mol. IUPAC name: sodium;9,10-dioxoanthracene-2-sulfonate;hydrate. InChIKey: KHILLYASAGTPOI-UHFFFAOYSA-M.
| Molecular formula | C14H9NaO6S |
|---|---|
| Molecular weight | 328.27 g/mol |
| IUPAC name | sodium;9,10-dioxoanthracene-2-sulfonate;hydrate |
| InChIKey | KHILLYASAGTPOI-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)