CAS 15332-94-2 appears in our catalog under these names: Amino-peg11-alcohol, 95%, Amino–PEG11–OH, Amino-PEG11-OH 95%, Amino-PEG11-OH, 95%, 95%, Amino-PEG11-OH. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 50mg, 50 mg, 250 mg, 10 mg, 5 mg.
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 15332-94-2) is a chemical compound with the molecular formula C22H47NO11 and a molecular weight of 501.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: BLECXSZYDGHWFZ-UHFFFAOYSA-N.
| Molecular formula | C22H47NO11 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | BLECXSZYDGHWFZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)N |
Computed by PubChem (NCBI)