Products 1533519-93-5

CAS 1533519-93-5 is the registry number for Lesinurad Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

2-[[4-(4-cyclopropylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 1533519-93-5) is a chemical compound with the molecular formula C17H15N3O2S and a molecular weight of 325.4 g/mol. IUPAC name: 2-[[4-(4-cyclopropylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: RQKGPEVPDVPLDT-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15N3O2S
Molecular weight325.4 g/mol
IUPAC name2-[[4-(4-cyclopropylnaphthalen-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid
InChIKeyRQKGPEVPDVPLDT-UHFFFAOYSA-N
SMILESC1CC1C2=CC=C(C3=CC=CC=C23)N4C=NN=C4SCC(=O)O

Computed by PubChem (NCBI)