CAS 1533519-94-6 appears in our catalog under these names: Lesinurad Impurity 10, 2-((5-Bromo-4-(1-cyclopropyl-2-naphthalenyl)-4H-1,2,4-triazol-3-yl)thio)-acetic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
2-[[5-bromo-4-(1-cyclopropylnaphthalen-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 1533519-94-6) is a chemical compound with the molecular formula C17H14BrN3O2S and a molecular weight of 404.3 g/mol. IUPAC name: 2-[[5-bromo-4-(1-cyclopropylnaphthalen-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: RNYAOLJMDAJRMF-UHFFFAOYSA-N.
| Molecular formula | C17H14BrN3O2S |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 2-[[5-bromo-4-(1-cyclopropylnaphthalen-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | RNYAOLJMDAJRMF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=CC3=CC=CC=C32)N4C(=NN=C4Br)SCC(=O)O |
Computed by PubChem (NCBI)