CAS 153381-14-7 appears in our catalog under these names: 1'-Epi 2',2'-Difluoro-2'-deoxyuridine, 2'-Deoxy-2',2'-difluoro-a-uridine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 2mg, 50mg.
1-[(2S,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 153381-14-7) is a chemical compound with the molecular formula C9H10F2N2O5 and a molecular weight of 264.18 g/mol. IUPAC name: 1-[(2S,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: FIRDBEQIJQERSE-PIYBLCFFSA-N.
| Molecular formula | C9H10F2N2O5 |
|---|---|
| Molecular weight | 264.18 g/mol |
| IUPAC name | 1-[(2S,4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | FIRDBEQIJQERSE-PIYBLCFFSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@@H]2C([C@H]([C@H](O2)CO)O)(F)F |
Computed by PubChem (NCBI)