CAS 153408-27-6 appears in our catalog under these names: Azelastine Impurity 2, (S)-Azelastine Hydrochloride, >95% (HPLC), (S)-Azelastine (hydrochloride). Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
4-[(4-chlorophenyl)methyl]-2-[(4S)-1-methylazepan-4-yl]phthalazin-1-one;hydrochloride (CAS 153408-27-6) is a chemical compound with the molecular formula C22H25Cl2N3O and a molecular weight of 418.4 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]-2-[(4S)-1-methylazepan-4-yl]phthalazin-1-one;hydrochloride. InChIKey: YEJAJYAHJQIWNU-FERBBOLQSA-N.
| Molecular formula | C22H25Cl2N3O |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]-2-[(4S)-1-methylazepan-4-yl]phthalazin-1-one;hydrochloride |
| InChIKey | YEJAJYAHJQIWNU-FERBBOLQSA-N |
| SMILES | CN1CCC[C@@H](CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl.Cl |
Computed by PubChem (NCBI)