Products 153415-44-2
CAS 153415-44-2 is the registry number for LEK 8804. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(6aR,9R)-N,7-dimethyl-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 153415-44-2) is a chemical compound with the molecular formula C20H21N3O and a molecular weight of 319.4 g/mol. IUPAC name: (6aR,9R)-N,7-dimethyl-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: NTIBYWGZNANJNM-RDTXWAMCSA-N.
| Molecular formula | C20H21N3O |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (6aR,9R)-N,7-dimethyl-N-prop-2-ynyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | NTIBYWGZNANJNM-RDTXWAMCSA-N |
| SMILES | CN1C[C@@H](C=C2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)N(C)CC#C |
Computed by PubChem (NCBI)