Products 1534980-04-5
CAS 1534980-04-5 appears in our catalog under these names: 2-Bromo-3-fluorobenzenepropanenitrile, 3-(2-Bromo-3-fluorophenyl)propanenitrile. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 10mg.
3-(2-bromo-3-fluorophenyl)propanenitrile (CAS 1534980-04-5) is a chemical compound with the molecular formula C9H7BrFN and a molecular weight of 228.06 g/mol. IUPAC name: 3-(2-bromo-3-fluorophenyl)propanenitrile. InChIKey: SZMOCPATRKLEBW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFN |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | 3-(2-bromo-3-fluorophenyl)propanenitrile |
| InChIKey | SZMOCPATRKLEBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)CCC#N |
Computed by PubChem (NCBI)