Products 153504-79-1
CAS 153504-79-1 is the registry number for 5-Bromo-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-bromo-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione (CAS 153504-79-1) is a chemical compound with the molecular formula C9H4BrF3N2O2 and a molecular weight of 309.04 g/mol. IUPAC name: 5-bromo-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione. InChIKey: XRZJFNLLFBTUGL-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3N2O2 |
|---|---|
| Molecular weight | 309.04 g/mol |
| IUPAC name | 5-bromo-7-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | XRZJFNLLFBTUGL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C(=O)N2)Br)C(F)(F)F |
Computed by PubChem (NCBI)