CAS 153504-81-5 appears in our catalog under these names: Licostinel, Licostinel, 97%, Licostinel/ 98.02% (existing batch purity), Licostinel 97%, 6,7-Dichloro-1,4-dihydro-5-nitro-2,3-quinoxalinedione. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1g, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg.
6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dione (CAS 153504-81-5) is a chemical compound with the molecular formula C8H3Cl2N3O4 and a molecular weight of 276.03 g/mol. IUPAC name: 6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dione. InChIKey: CHFSOFHQIZKQCR-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3O4 |
|---|---|
| Molecular weight | 276.03 g/mol |
| IUPAC name | 6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | CHFSOFHQIZKQCR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Cl)Cl)[N+](=O)[O-])NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)