CAS 1535163-09-7 is the registry number for (1S,2R)-2-(Hydroxymethyl)-1-phenylcyclopropanecarbonitrile. Offered by: TRC. Available pack sizes: 25mg.
Cis-(1S,2R)-2-(hydroxymethyl)-1-phenylcyclopropane-1-carbonitrile (CAS 1535163-09-7) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: cis-(1S,2R)-2-(hydroxymethyl)-1-phenylcyclopropane-1-carbonitrile. InChIKey: YDIYUDSRGPPHKA-WDEREUQCSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | cis-(1S,2R)-2-(hydroxymethyl)-1-phenylcyclopropane-1-carbonitrile |
| InChIKey | YDIYUDSRGPPHKA-WDEREUQCSA-N |
| SMILES | C1[C@H]([C@]1(C#N)C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)