CAS 1535224-93-1 is the registry number for 4,10-Bis(2-naphthalenylthio)-chrysene. Offered by: TRC. Available pack sizes: 250mg.
4,10-bis(naphthalen-2-ylsulfanyl)chrysene (CAS 1535224-93-1) is a chemical compound with the molecular formula C38H24S2 and a molecular weight of 544.7 g/mol. IUPAC name: 4,10-bis(naphthalen-2-ylsulfanyl)chrysene. InChIKey: DMDTXTYUSMFBRU-UHFFFAOYSA-N.
| Molecular formula | C38H24S2 |
|---|---|
| Molecular weight | 544.7 g/mol |
| IUPAC name | 4,10-bis(naphthalen-2-ylsulfanyl)chrysene |
| InChIKey | DMDTXTYUSMFBRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)SC3=CC=CC4=C3C5=C(C=C4)C6=C(C=CC=C6SC7=CC8=CC=CC=C8C=C7)C=C5 |
Computed by PubChem (NCBI)