Products 1535287-37-6

CAS 1535287-37-6 is the registry number for 3-(1,4-Dimethyl-1H-pyrazol-5-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(1,4-dimethylpyrazol-5-yl)propanoic acid (CAS 1535287-37-6) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 3-(1,4-dimethylpyrazol-5-yl)propanoic acid. InChIKey: QIQWYZHMHHHKJW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12N2O2
Molecular weight168.19 g/mol
IUPAC name3-(1,4-dimethylpyrazol-5-yl)propanoic acid
InChIKeyQIQWYZHMHHHKJW-UHFFFAOYSA-N
SMILESCC1=C(N(N=C1)C)CCC(=O)O

Computed by PubChem (NCBI)