Products 1535482-02-0

CAS 1535482-02-0 is the registry number for 2-(4,4-Dimethylcyclohexyl)-2-fluoroacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4,4-dimethylcyclohexyl)-2-fluoroacetic acid (CAS 1535482-02-0) is a chemical compound with the molecular formula C10H17FO2 and a molecular weight of 188.24 g/mol. IUPAC name: 2-(4,4-dimethylcyclohexyl)-2-fluoroacetic acid. InChIKey: SEEDYNYLMJFWRV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17FO2
Molecular weight188.24 g/mol
IUPAC name2-(4,4-dimethylcyclohexyl)-2-fluoroacetic acid
InChIKeySEEDYNYLMJFWRV-UHFFFAOYSA-N
SMILESCC1(CCC(CC1)C(C(=O)O)F)C

Computed by PubChem (NCBI)