Products 153559-44-5
CAS 153559-44-5 is the registry number for 6-((3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl) Nicotinic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Methyl 6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-3-carboxylate (CAS 153559-44-5) is a chemical compound with the molecular formula C24H29NO2 and a molecular weight of 363.5 g/mol. IUPAC name: methyl 6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-3-carboxylate. InChIKey: YNHDHMOGKZWQBF-UHFFFAOYSA-N.
| Molecular formula | C24H29NO2 |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | methyl 6-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-3-carboxylate |
| InChIKey | YNHDHMOGKZWQBF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=C)C3=NC=C(C=C3)C(=O)OC)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)