Products 47523-05-7
CAS 47523-05-7 is the registry number for 4-Phenoxy Levomethorphan. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
(1R,9R,10R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (CAS 47523-05-7) is a chemical compound with the molecular formula C24H29NO2 and a molecular weight of 363.5 g/mol. IUPAC name: (1R,9R,10R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene. InChIKey: FGMSEQUOXWPSMD-DCLXLUIPSA-N.
| Molecular formula | C24H29NO2 |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | (1R,9R,10R)-4-methoxy-17-methyl-3-phenoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| InChIKey | FGMSEQUOXWPSMD-DCLXLUIPSA-N |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1CC4=C3C(=C(C=C4)OC)OC5=CC=CC=C5 |
Computed by PubChem (NCBI)