CAS 153559-48-9 appears in our catalog under these names: Methyl 4-(1-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)vinyl)benzoate, 95%, Bexarotene Impurity 5, Methyl Bexarotenate, >95% (HPLC), Bexarotene-13C4 Methyl Ester, Methyl 4-(1-(3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)vinyl)benzoate 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 1g, on request, 25mg, 50mg.
Methyl 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate (CAS 153559-48-9) is a chemical compound with the molecular formula C25H30O2 and a molecular weight of 362.5 g/mol. IUPAC name: methyl 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate. InChIKey: VSMOGQLTPWIBNI-UHFFFAOYSA-N.
| Molecular formula | C25H30O2 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | methyl 4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate |
| InChIKey | VSMOGQLTPWIBNI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=C)C3=CC=C(C=C3)C(=O)OC)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)