CAS 153559-61-6 is the registry number for 4-(2-(5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)-2-oxiranyl)benzoic acid. Offered by: TRC. Available pack sizes: 100mg.
4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxiran-2-yl]benzoic acid (CAS 153559-61-6) is a chemical compound with the molecular formula C24H28O3 and a molecular weight of 364.5 g/mol. IUPAC name: 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxiran-2-yl]benzoic acid. InChIKey: DAUWSBRWCVRVRP-UHFFFAOYSA-N.
| Molecular formula | C24H28O3 |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxiran-2-yl]benzoic acid |
| InChIKey | DAUWSBRWCVRVRP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C3(CO3)C4=CC=C(C=C4)C(=O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)