Products 153596-79-3
CAS 153596-79-3 is the registry number for tert-Butyl (2-Hydroxyethyl-d4)carbamate. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)carbamate (CAS 153596-79-3) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 165.22 g/mol. IUPAC name: tert-butyl N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)carbamate. InChIKey: GPTXCAZYUMDUMN-CQOLUAMGSA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 165.22 g/mol |
| IUPAC name | tert-butyl N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)carbamate |
| InChIKey | GPTXCAZYUMDUMN-CQOLUAMGSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl (2-Hydroxyethyl-d4)carbamate