CAS 1535999-70-2 is the registry number for 5-Amino-6-(trifluoromethyl)pyridin-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-6-(trifluoromethyl)-1H-pyridin-2-one (CAS 1535999-70-2) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 5-amino-6-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: ZUGQVCVZCFYOEM-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 5-amino-6-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | ZUGQVCVZCFYOEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1N)C(F)(F)F |
Computed by PubChem (NCBI)