CAS 153600-17-0 is the registry number for 2,4-difluoro-5-(trifluoromethyl)pyrimidine. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-difluoro-5-(trifluoromethyl)pyrimidine (CAS 153600-17-0) is a chemical compound with the molecular formula C5HF5N2 and a molecular weight of 184.07 g/mol. IUPAC name: 2,4-difluoro-5-(trifluoromethyl)pyrimidine. InChIKey: YXYCPKOAGWDZKX-UHFFFAOYSA-N.
| Molecular formula | C5HF5N2 |
|---|---|
| Molecular weight | 184.07 g/mol |
| IUPAC name | 2,4-difluoro-5-(trifluoromethyl)pyrimidine |
| InChIKey | YXYCPKOAGWDZKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)F)F)C(F)(F)F |
Computed by PubChem (NCBI)