CAS 1536007-42-7 appears in our catalog under these names: (1,1-Dioxidotetrahydrothiophen-3-yl)(methyl)carbamic chloride, 95%, N-​Methyl-​N-​(tetrahydro-​1,​1-​dioxido-​3-​thienyl)​-carbamic chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
N-(1,1-dioxothiolan-3-yl)-N-methylcarbamoyl chloride (CAS 1536007-42-7) is a chemical compound with the molecular formula C6H10ClNO3S and a molecular weight of 211.67 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-N-methylcarbamoyl chloride. InChIKey: NUPTXLMTIZIQNA-UHFFFAOYSA-N.
| Molecular formula | C6H10ClNO3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-N-methylcarbamoyl chloride |
| InChIKey | NUPTXLMTIZIQNA-UHFFFAOYSA-N |
| SMILES | CN(C1CCS(=O)(=O)C1)C(=O)Cl |
Computed by PubChem (NCBI)