Products 1536007-42-7

CAS 1536007-42-7 appears in our catalog under these names: (1,1-Dioxidotetrahydrothiophen-3-yl)(methyl)carbamic chloride, 95%, N-​Methyl-​N-​(tetrahydro-​1,​1-​dioxido-​3-​thienyl)​-carbamic chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

N-(1,1-dioxothiolan-3-yl)-N-methylcarbamoyl chloride (CAS 1536007-42-7) is a chemical compound with the molecular formula C6H10ClNO3S and a molecular weight of 211.67 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-N-methylcarbamoyl chloride. InChIKey: NUPTXLMTIZIQNA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClNO3S
Molecular weight211.67 g/mol
IUPAC nameN-(1,1-dioxothiolan-3-yl)-N-methylcarbamoyl chloride
InChIKeyNUPTXLMTIZIQNA-UHFFFAOYSA-N
SMILESCN(C1CCS(=O)(=O)C1)C(=O)Cl

Computed by PubChem (NCBI)