Products 153608-99-2
CAS 153608-99-2 is the registry number for YM114. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3-dihydroindol-1-yl-[(5R)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone;hydrochloride (CAS 153608-99-2) is a chemical compound with the molecular formula C16H18ClN3O and a molecular weight of 303.78 g/mol. IUPAC name: 2,3-dihydroindol-1-yl-[(5R)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone;hydrochloride. InChIKey: GZXONPGTMHLBKQ-UTONKHPSSA-N.
| Molecular formula | C16H18ClN3O |
|---|---|
| Molecular weight | 303.78 g/mol |
| IUPAC name | 2,3-dihydroindol-1-yl-[(5R)-4,5,6,7-tetrahydro-3H-benzimidazol-5-yl]methanone;hydrochloride |
| InChIKey | GZXONPGTMHLBKQ-UTONKHPSSA-N |
| SMILES | C1CC2=C(C[C@@H]1C(=O)N3CCC4=CC=CC=C43)NC=N2.Cl |
Computed by PubChem (NCBI)