CAS 1536314-14-3 appears in our catalog under these names: 2,2,5,5-Tetramethyloxolane-3-carboxylic acid, 2,2,5,5-Tetramethyloxolane-3-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2,2,5,5-tetramethyloxolane-3-carboxylic acid (CAS 1536314-14-3) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: 2,2,5,5-tetramethyloxolane-3-carboxylic acid. InChIKey: RRNJAOWNKAECIX-UHFFFAOYSA-N.
| Molecular formula | C9H16O3 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 2,2,5,5-tetramethyloxolane-3-carboxylic acid |
| InChIKey | RRNJAOWNKAECIX-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(O1)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)