CAS 1536395-80-8 is the registry number for Ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-ene-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-ene-1-carboxylate (CAS 1536395-80-8) is a chemical compound with the molecular formula C15H25BO4 and a molecular weight of 280.17 g/mol. IUPAC name: ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-ene-1-carboxylate. InChIKey: NHKKKXHQIGJDOF-UHFFFAOYSA-N.
| Molecular formula | C15H25BO4 |
|---|---|
| Molecular weight | 280.17 g/mol |
| IUPAC name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-ene-1-carboxylate |
| InChIKey | NHKKKXHQIGJDOF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(CCC2)C(=O)OCC |
Computed by PubChem (NCBI)