CAS 1536547-72-4 is the registry number for 2-Azido-3-bromopyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-azido-3-bromopyridine (CAS 1536547-72-4) is a chemical compound with the molecular formula C5H3BrN4 and a molecular weight of 199.01 g/mol. IUPAC name: 2-azido-3-bromopyridine. InChIKey: GHYSNRLIFGOMDZ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN4 |
|---|---|
| Molecular weight | 199.01 g/mol |
| IUPAC name | 2-azido-3-bromopyridine |
| InChIKey | GHYSNRLIFGOMDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N=[N+]=[N-])Br |
Computed by PubChem (NCBI)