Products 15366-29-7

CAS 15366-29-7 is the registry number for Creatine ethyl ester, 90.000000%. Offered by: MedChemExpress. Available pack sizes: 1 mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[carbamimidoyl(methyl)amino]acetate (CAS 15366-29-7) is a chemical compound with the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. IUPAC name: ethyl 2-[carbamimidoyl(methyl)amino]acetate. InChIKey: UFUWQSYRGLMLKP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13N3O2
Molecular weight159.19 g/mol
IUPAC nameethyl 2-[carbamimidoyl(methyl)amino]acetate
InChIKeyUFUWQSYRGLMLKP-UHFFFAOYSA-N
SMILESCCOC(=O)CN(C)C(=N)N

Computed by PubChem (NCBI)