CAS 1536748-94-3 is the registry number for 3-Amino-5-fluoro-n-(2,2,2-trifluoroethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide (CAS 1536748-94-3) is a chemical compound with the molecular formula C9H8F4N2O and a molecular weight of 236.17 g/mol. IUPAC name: 3-amino-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: OICVKMAOWJZUHU-UHFFFAOYSA-N.
| Molecular formula | C9H8F4N2O |
|---|---|
| Molecular weight | 236.17 g/mol |
| IUPAC name | 3-amino-5-fluoro-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | OICVKMAOWJZUHU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)F)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)