CAS 1537180-08-7 appears in our catalog under these names: Roxadustat Impurity 36, Roxadustat Impurity 24. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 4-acetyloxy-1-(acetyloxymethyl)-7-phenoxyisoquinoline-3-carboxylate (CAS 1537180-08-7) is a chemical compound with the molecular formula C22H19NO7 and a molecular weight of 409.4 g/mol. IUPAC name: methyl 4-acetyloxy-1-(acetyloxymethyl)-7-phenoxyisoquinoline-3-carboxylate. InChIKey: KAICFPDYJUONAF-UHFFFAOYSA-N.
| Molecular formula | C22H19NO7 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | methyl 4-acetyloxy-1-(acetyloxymethyl)-7-phenoxyisoquinoline-3-carboxylate |
| InChIKey | KAICFPDYJUONAF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=NC(=C(C2=C1C=C(C=C2)OC3=CC=CC=C3)OC(=O)C)C(=O)OC |
Computed by PubChem (NCBI)