Products 153725-00-9
CAS 153725-00-9 is the registry number for Methyl (E)-2,2-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-2,2-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate (CAS 153725-00-9) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: methyl (E)-2,2-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate. InChIKey: IFCXUPGMXPOCPE-CSKARUKUSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | methyl (E)-2,2-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate |
| InChIKey | IFCXUPGMXPOCPE-CSKARUKUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CC(C)(C)C(=O)OC |
Computed by PubChem (NCBI)