Products 2451265-37-3
CAS 2451265-37-3 is the registry number for tert-Butyl (Z)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate (CAS 2451265-37-3) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate. InChIKey: CYRJZJAKGYDHIQ-UHFFFAOYSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoate |
| InChIKey | CYRJZJAKGYDHIQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=CCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)