CAS 1537324-26-7 is the registry number for 2-(4-chloro-2-fluorophenyl)butan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chloro-2-fluorophenyl)butan-2-ol (CAS 1537324-26-7) is a chemical compound with the molecular formula C10H12ClFO and a molecular weight of 202.65 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenyl)butan-2-ol. InChIKey: WANOXMIQLCKTJR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFO |
|---|---|
| Molecular weight | 202.65 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenyl)butan-2-ol |
| InChIKey | WANOXMIQLCKTJR-UHFFFAOYSA-N |
| SMILES | CCC(C)(C1=C(C=C(C=C1)Cl)F)O |
Computed by PubChem (NCBI)